![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Protein secondary structure prediction based on position-specific scoring matrices.ppt | 2013-05-28 04:42 | 910K | |
| Protein secondary structure prediction based on position-specific scoring matrices.pdf | 2013-05-28 04:42 | 221K | |
| Clustering of highly homologous sequences to reduce the.ppt | 2013-05-28 04:42 | 140K | |
| 282.pdf | 2013-05-28 04:42 | 61K | |
| 3D-Jury a Simple Approach to Improve Protein Structure Predictions.pdf | 2013-05-28 04:42 | 50K | |
| 3D-Jury A Simple Approach to Improve Protein Structure Predictions .ppt | 2013-05-28 04:42 | 379K | |
| 061130.ppt | 2013-05-28 04:42 | 491K | |
| (2000)Application of multiple sequence alignemnt profiles to improve protein secondary structure prediction.pdf | 2013-05-28 04:42 | 298K | |