![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Alg for mod anal.pdf | 2013-05-28 04:42 | 151K | |
| Alg for mod anal.ppt | 2013-05-28 04:42 | 343K | |
| Development and validation of a consistency based multiple structure alignment algorithm.pdf | 2013-05-28 04:42 | 277K | |
| Development and validation of a consistency based multiple structure alignment algorithm.ppt | 2013-05-28 04:42 | 1.4M | |
| Efficient parameterized string matching.ppt | 2013-05-28 04:42 | 298K | |
| Thumbs.db | 2013-05-28 04:42 | 6.5K | |