![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Sequence Comparison with Mixed Convex and Concave Costs.pdf | 2016-04-19 21:44 | 913K | |
| Sequence Comparison with Concave Weighting Functions.pdf | 2016-04-19 21:43 | 1.3M | |
| Identification of common molecular subsequences_Smith_waterman1981.pdf | 2016-04-19 21:36 | 163K | |
| Efficient sequence alignment algorithms.pdf | 2016-04-19 21:40 | 198K | |
![[ ]](/icons/unknown.gif) | 20160419_linxl.pptx | 2016-04-19 21:44 | 452K | |
| 20160419_linbs.pptx | 2016-04-19 21:43 | 544K | |
| 20160419_hungsh.pptx | 2016-04-19 21:36 | 126K | |
| 20160419_ciousz.pptx | 2016-04-19 21:40 | 228K | |
|
|---|