![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Mining Sequenctial Patterns by Pattern-Growth(The PrefixSpan Approach).ppt | 2013-05-28 04:42 | 897K | |
| Mining Sequenctial Patterns by Pattern-Growth.pdf | 2013-05-28 04:42 | 1.3M | |
| Protein structure prediction using mutually orthogonal Latin squares and a genetic algorithm.pdf | 2013-05-28 04:42 | 390K | |
| Protein structure prediction using mutually orthogonal Latin squares and a genetic algorithm.ppt | 2013-05-28 04:42 | 590K | |